2017-10-21 10:16:03 +02:00
|
|
|
// Copyright (c) 2017 fd developers
|
|
|
|
// Licensed under the Apache License, Version 2.0
|
|
|
|
// <LICENSE-APACHE or http://www.apache.org/licenses/LICENSE-2.0>
|
|
|
|
// or the MIT license <LICENSE-MIT or http://opensource.org/licenses/MIT>,
|
|
|
|
// at your option. All files in the project carrying such
|
|
|
|
// notice may not be copied, modified, or distributed except
|
|
|
|
// according to those terms.
|
|
|
|
|
2017-06-05 14:14:01 +02:00
|
|
|
/// A parser for the `LS_COLORS` environment variable.
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-06-05 14:14:01 +02:00
|
|
|
use std::collections::HashMap;
|
2017-10-05 21:29:29 +02:00
|
|
|
use ansi_term::{Colour, Style};
|
2017-06-01 22:46:15 +02:00
|
|
|
|
|
|
|
/// Maps file extensions to ANSI colors / styles.
|
|
|
|
pub type ExtensionStyles = HashMap<String, Style>;
|
|
|
|
|
|
|
|
/// Maps filenames to ANSI colors / styles.
|
|
|
|
pub type FilenameStyles = HashMap<String, Style>;
|
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
const LS_CODES: &'static [&'static str] = &[
|
|
|
|
"no",
|
|
|
|
"no",
|
|
|
|
"fi",
|
|
|
|
"rs",
|
|
|
|
"di",
|
|
|
|
"ln",
|
|
|
|
"ln",
|
|
|
|
"ln",
|
|
|
|
"or",
|
|
|
|
"mi",
|
|
|
|
"pi",
|
|
|
|
"pi",
|
|
|
|
"so",
|
|
|
|
"bd",
|
|
|
|
"bd",
|
|
|
|
"cd",
|
|
|
|
"cd",
|
|
|
|
"do",
|
|
|
|
"ex",
|
|
|
|
"lc",
|
|
|
|
"lc",
|
|
|
|
"rc",
|
|
|
|
"rc",
|
|
|
|
"ec",
|
|
|
|
"ec",
|
|
|
|
"su",
|
|
|
|
"su",
|
|
|
|
"sg",
|
|
|
|
"sg",
|
|
|
|
"st",
|
|
|
|
"ow",
|
|
|
|
"ow",
|
|
|
|
"tw",
|
|
|
|
"tw",
|
|
|
|
"ca",
|
|
|
|
"mh",
|
|
|
|
"cl",
|
|
|
|
];
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-06-05 14:14:01 +02:00
|
|
|
/// Defines how different file system entries should be colorized / styled.
|
2017-06-01 22:46:15 +02:00
|
|
|
#[derive(Debug, PartialEq)]
|
|
|
|
pub struct LsColors {
|
2017-06-05 14:14:01 +02:00
|
|
|
/// ANSI Style for directories.
|
2017-06-01 22:46:15 +02:00
|
|
|
pub directory: Style,
|
2017-06-05 14:14:01 +02:00
|
|
|
|
|
|
|
/// ANSI style for symbolic links.
|
2017-06-01 22:46:15 +02:00
|
|
|
pub symlink: Style,
|
2017-06-05 14:14:01 +02:00
|
|
|
|
2017-06-05 21:50:46 +02:00
|
|
|
/// ANSI style for executable files.
|
|
|
|
pub executable: Style,
|
|
|
|
|
2017-06-05 14:14:01 +02:00
|
|
|
/// A map that defines ANSI styles for different file extensions.
|
2017-06-01 22:46:15 +02:00
|
|
|
pub extensions: ExtensionStyles,
|
2017-06-05 14:14:01 +02:00
|
|
|
|
|
|
|
/// A map that defines ANSI styles for different specific filenames.
|
2017-06-01 22:46:15 +02:00
|
|
|
pub filenames: FilenameStyles,
|
|
|
|
}
|
|
|
|
|
2017-06-03 23:28:32 +02:00
|
|
|
impl Default for LsColors {
|
2017-06-01 22:46:15 +02:00
|
|
|
/// Get a default LsColors structure.
|
2017-06-03 23:28:32 +02:00
|
|
|
fn default() -> LsColors {
|
2017-06-01 22:46:15 +02:00
|
|
|
LsColors {
|
|
|
|
directory: Colour::Blue.bold(),
|
|
|
|
symlink: Colour::Cyan.normal(),
|
2017-06-05 21:50:46 +02:00
|
|
|
executable: Colour::Red.bold(),
|
2017-06-01 22:46:15 +02:00
|
|
|
extensions: HashMap::new(),
|
2017-10-05 21:29:29 +02:00
|
|
|
filenames: HashMap::new(),
|
2017-06-01 22:46:15 +02:00
|
|
|
}
|
|
|
|
}
|
2017-06-03 23:28:32 +02:00
|
|
|
}
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-06-03 23:28:32 +02:00
|
|
|
impl LsColors {
|
2017-06-05 14:14:01 +02:00
|
|
|
/// Parse a single text-decoration code (normal, bold, italic, ...).
|
2017-06-02 21:54:21 +02:00
|
|
|
fn parse_decoration(code: &str) -> Option<fn(Colour) -> Style> {
|
|
|
|
match code {
|
|
|
|
"0" | "00" => Some(Colour::normal),
|
|
|
|
"1" | "01" => Some(Colour::bold),
|
|
|
|
"3" | "03" => Some(Colour::italic),
|
|
|
|
"4" | "04" => Some(Colour::underline),
|
2017-10-05 21:29:29 +02:00
|
|
|
_ => None,
|
2017-06-02 21:54:21 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Parse ANSI escape sequences like `38;5;10;1`.
|
2017-06-01 22:46:15 +02:00
|
|
|
fn parse_style(code: &str) -> Option<Style> {
|
2017-06-03 23:28:32 +02:00
|
|
|
let mut split = code.split(';');
|
2017-06-01 22:46:15 +02:00
|
|
|
|
|
|
|
if let Some(first) = split.next() {
|
2017-06-02 21:54:21 +02:00
|
|
|
// Try to match the first part as a text-decoration argument
|
|
|
|
let mut decoration = LsColors::parse_decoration(first);
|
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
let c1 = if decoration.is_none() {
|
|
|
|
Some(first)
|
|
|
|
} else {
|
|
|
|
split.next()
|
|
|
|
};
|
2017-06-02 21:54:21 +02:00
|
|
|
let c2 = split.next();
|
|
|
|
let c3 = split.next();
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
let color = if c1 == Some("38") && c2 == Some("5") {
|
|
|
|
let n_white = 7;
|
|
|
|
let n = if let Some(num) = c3 {
|
|
|
|
u8::from_str_radix(num, 10).unwrap_or(n_white)
|
2017-06-03 23:28:32 +02:00
|
|
|
} else {
|
2017-10-12 08:01:51 +02:00
|
|
|
n_white
|
2017-06-01 22:46:15 +02:00
|
|
|
};
|
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
Colour::Fixed(n)
|
|
|
|
} else if let Some(color_s) = c1 {
|
|
|
|
match color_s {
|
|
|
|
"30" => Colour::Black,
|
|
|
|
"31" => Colour::Red,
|
|
|
|
"32" => Colour::Green,
|
|
|
|
"33" => Colour::Yellow,
|
|
|
|
"34" => Colour::Blue,
|
|
|
|
"35" => Colour::Purple,
|
|
|
|
"36" => Colour::Cyan,
|
|
|
|
_ => Colour::White,
|
|
|
|
}
|
|
|
|
} else {
|
|
|
|
Colour::White
|
|
|
|
};
|
|
|
|
|
2017-06-02 21:54:21 +02:00
|
|
|
if decoration.is_none() {
|
|
|
|
// Try to find a decoration somewhere in the sequence
|
2017-10-12 08:01:51 +02:00
|
|
|
decoration = code.split(';').flat_map(LsColors::parse_decoration).next();
|
2017-06-02 21:54:21 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
let ansi_style = decoration.unwrap_or(Colour::normal)(color);
|
|
|
|
|
|
|
|
Some(ansi_style)
|
2017-06-01 22:46:15 +02:00
|
|
|
} else {
|
|
|
|
None
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2017-06-05 14:14:01 +02:00
|
|
|
/// Add a new `LS_COLORS` entry.
|
2017-06-01 22:46:15 +02:00
|
|
|
fn add_entry(&mut self, input: &str) {
|
2017-06-03 23:28:32 +02:00
|
|
|
let mut parts = input.trim().split('=');
|
2017-06-01 22:46:15 +02:00
|
|
|
if let Some(pattern) = parts.next() {
|
|
|
|
if let Some(style_code) = parts.next() {
|
|
|
|
// Ensure that the input was split into exactly two parts:
|
|
|
|
if !parts.next().is_none() {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
if let Some(style) = LsColors::parse_style(style_code) {
|
|
|
|
// Try to match against one of the known codes
|
|
|
|
let res = LS_CODES.iter().find(|&&c| c == pattern);
|
|
|
|
|
|
|
|
if let Some(code) = res {
|
|
|
|
match code.as_ref() {
|
|
|
|
"di" => self.directory = style,
|
|
|
|
"ln" => self.symlink = style,
|
2017-06-05 21:50:46 +02:00
|
|
|
"ex" => self.executable = style,
|
2017-10-12 08:01:51 +02:00
|
|
|
_ => return,
|
2017-06-01 22:46:15 +02:00
|
|
|
}
|
|
|
|
} else if pattern.starts_with("*.") {
|
|
|
|
let extension = String::from(pattern).split_off(2);
|
|
|
|
self.extensions.insert(extension, style);
|
2017-10-12 08:01:51 +02:00
|
|
|
} else if pattern.starts_with('*') {
|
2017-06-01 22:46:15 +02:00
|
|
|
let filename = String::from(pattern).split_off(1);
|
2017-06-01 23:08:02 +02:00
|
|
|
self.filenames.insert(filename, style);
|
2017-06-01 22:46:15 +02:00
|
|
|
} else {
|
|
|
|
// Unknown/corrupt pattern
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Generate a `LsColors` structure from a string.
|
2017-06-03 23:28:32 +02:00
|
|
|
pub fn from_string(input: &str) -> LsColors {
|
2017-06-01 22:46:15 +02:00
|
|
|
let mut lscolors = LsColors::default();
|
|
|
|
|
2017-06-03 23:28:32 +02:00
|
|
|
for s in input.split(':') {
|
|
|
|
lscolors.add_entry(s);
|
2017-06-01 22:46:15 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
lscolors
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
#[test]
|
2017-06-02 21:54:21 +02:00
|
|
|
fn test_parse_simple() {
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Red.normal()), LsColors::parse_style("31"));
|
2017-06-02 21:54:21 +02:00
|
|
|
}
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-06-02 21:54:21 +02:00
|
|
|
#[test]
|
|
|
|
fn test_parse_decoration() {
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Red.normal()), LsColors::parse_style("00;31"));
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Blue.italic()), LsColors::parse_style("03;34"));
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Cyan.bold()), LsColors::parse_style("01;36"));
|
2017-06-02 21:54:21 +02:00
|
|
|
}
|
2017-06-01 22:46:15 +02:00
|
|
|
|
2017-06-02 21:54:21 +02:00
|
|
|
#[test]
|
|
|
|
fn test_parse_decoration_backwards() {
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Blue.italic()), LsColors::parse_style("34;03"));
|
2017-06-02 21:54:21 +02:00
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Cyan.bold()), LsColors::parse_style("36;01"));
|
2017-06-02 21:54:21 +02:00
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(Some(Colour::Red.normal()), LsColors::parse_style("31;00"));
|
2017-06-02 21:54:21 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
#[test]
|
|
|
|
fn test_parse_256() {
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(
|
|
|
|
Some(Colour::Fixed(115).normal()),
|
|
|
|
LsColors::parse_style("38;5;115")
|
|
|
|
);
|
|
|
|
|
|
|
|
assert_eq!(
|
|
|
|
Some(Colour::Fixed(115).normal()),
|
|
|
|
LsColors::parse_style("00;38;5;115")
|
|
|
|
);
|
|
|
|
|
|
|
|
assert_eq!(
|
|
|
|
Some(Colour::Fixed(119).bold()),
|
|
|
|
LsColors::parse_style("01;38;5;119")
|
|
|
|
);
|
|
|
|
|
|
|
|
assert_eq!(
|
|
|
|
Some(Colour::Fixed(119).bold()),
|
|
|
|
LsColors::parse_style("38;5;119;01")
|
|
|
|
);
|
2017-06-01 22:46:15 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
#[test]
|
2017-06-02 21:54:21 +02:00
|
|
|
fn test_from_string() {
|
2017-06-01 22:46:15 +02:00
|
|
|
assert_eq!(LsColors::default(), LsColors::from_string(&String::new()));
|
|
|
|
|
2017-10-12 08:01:51 +02:00
|
|
|
let result = LsColors::from_string(&String::from(
|
|
|
|
"rs=0:di=03;34:ln=01;36:*.foo=01;35:*README=33",
|
|
|
|
));
|
2017-06-01 22:46:15 +02:00
|
|
|
|
|
|
|
assert_eq!(Colour::Blue.italic(), result.directory);
|
|
|
|
assert_eq!(Colour::Cyan.bold(), result.symlink);
|
2017-06-01 23:08:02 +02:00
|
|
|
assert_eq!(Some(&Colour::Purple.bold()), result.extensions.get("foo"));
|
2017-10-12 08:01:51 +02:00
|
|
|
assert_eq!(
|
|
|
|
Some(&Colour::Yellow.normal()),
|
|
|
|
result.filenames.get("README")
|
|
|
|
);
|
2017-06-01 22:46:15 +02:00
|
|
|
}
|